C21H44O3Si2 — CID 134887200
trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-propylcyclohexan-1-one (PubChem CID 134887200) has the molecular formula C21H44O3Si2 and a molecular weight of 400.75 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-propylcyclohexan-1-one.
| Compound Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-propylcyclohexan-1-one |
|---|---|
| PubChem CID | 134887200 |
| Molecular Formula | C21H44O3Si2 |
| Molecular Weight | 400.75 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-propylcyclohexan-1-one |
| SMILES | CCCC1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O3Si2/c1-12-13-17-18(23-25(8,9)20(2,3)4)14-16(22)15-19(17)24-26(10,11)21(5,6)7/h17-19H,12-15H2,1-11H3/t18-,19-/m1/s1 |
| InChIKey | PIPTVOQPBWWOEK-RTBURBONSA-N |
| XLogP | 6.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.75 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|