C31H76O3Si8 — CID 139117668
(2R)-2-[(1R,3S)-4,4-dimethyl-1,3-bis[tris(trimethylsilyl)silyloxy]pentyl]cyclohexan-1-one (PubChem CID 139117668) has the molecular formula C31H76O3Si8 and a molecular weight of 721.63 g/mol. Its IUPAC name is (2R)-2-[(1R,3S)-4,4-dimethyl-1,3-bis[tris(trimethylsilyl)silyloxy]pentyl]cyclohexan-1-one.
| Compound Name | (2R)-2-[(1R,3S)-4,4-dimethyl-1,3-bis[tris(trimethylsilyl)silyloxy]pentyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 139117668 |
| Molecular Formula | C31H76O3Si8 |
| Molecular Weight | 721.63 g/mol |
| Exact Mass | 720.39 |
| IUPAC Name | (2R)-2-[(1R,3S)-4,4-dimethyl-1,3-bis[tris(trimethylsilyl)silyloxy]pentyl]cyclohexan-1-one |
| SMILES | CC(C)(C)[C@H](C[C@@H](O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)[C@H]1CCCCC1=O)O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C31H76O3Si8/c1-31(2,3)30(34-42(38(13,14)15,39(16,17)18)40(19,20)21)26-29(27-24-22-23-25-28(27)32)33-41(35(4,5)6,36(7,8)9)37(10,11)12/h27,29-30H,22-26H2,1-21H3/t27-,29+,30-/m0/s1 |
| InChIKey | SYEGELIMZUJPIW-SHSRKSKBSA-N |
| XLogP | 10.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.63 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|