C22H48O3Si2 — CID 554767
5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-7-triethylsilyloxyoctan-3-one (PubChem CID 554767) has the molecular formula C22H48O3Si2 and a molecular weight of 416.80 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-7-triethylsilyloxyoctan-3-one.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-7-triethylsilyloxyoctan-3-one |
|---|---|
| PubChem CID | 554767 |
| Molecular Formula | C22H48O3Si2 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-6-ethyl-7-triethylsilyloxyoctan-3-one |
| SMILES | CCC(=O)CC(O[Si](C)(C)C(C)(C)C)C(CC)C(C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H48O3Si2/c1-12-19(23)17-21(25-26(10,11)22(7,8)9)20(13-2)18(6)24-27(14-3,15-4)16-5/h18,20-21H,12-17H2,1-11H3 |
| InChIKey | MTUIMDVENMXPCK-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|