C21H46O3Si2 — CID 138975699
(4R,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyloctan-3-one (PubChem CID 138975699) has the molecular formula C21H46O3Si2 and a molecular weight of 402.77 g/mol. Its IUPAC name is (4R,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyloctan-3-one.
| Compound Name | (4R,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyloctan-3-one |
|---|---|
| PubChem CID | 138975699 |
| Molecular Formula | C21H46O3Si2 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (4R,5S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyloctan-3-one |
| SMILES | CCC(=O)[C@H](C)[C@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O3Si2/c1-14-18(22)17(3)19(24-26(12,13)21(7,8)9)15-16(2)23-25(10,11)20(4,5)6/h16-17,19H,14-15H2,1-13H3/t16-,17+,19+/m1/s1 |
| InChIKey | GAMANQWXKWKMEX-AOIWGVFYSA-N |
| XLogP | 6.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|