C18H36O4Si — CID 10020412
(2S,3S,4S,5R,6R)-5-(methoxymethoxy)-2,4,6-trimethyl-3-triethylsilyloxycycloheptan-1-one (PubChem CID 10020412) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-5-(methoxymethoxy)-2,4,6-trimethyl-3-triethylsilyloxycycloheptan-1-one.
| Compound Name | (2S,3S,4S,5R,6R)-5-(methoxymethoxy)-2,4,6-trimethyl-3-triethylsilyloxycycloheptan-1-one |
|---|---|
| PubChem CID | 10020412 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2S,3S,4S,5R,6R)-5-(methoxymethoxy)-2,4,6-trimethyl-3-triethylsilyloxycycloheptan-1-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@H](OCOC)[C@H](C)CC(=O)[C@H]1C |
| InChI | InChI=1S/C18H36O4Si/c1-8-23(9-2,10-3)22-18-14(5)16(19)11-13(4)17(15(18)6)21-12-20-7/h13-15,17-18H,8-12H2,1-7H3/t13-,14-,15+,17-,18-/m1/s1 |
| InChIKey | IUGOZUURUWWUMS-DMHIMHRUSA-N |
| XLogP | 4.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|