C24H46O4Si — CID 11796712
(2S,3R,4S,7S)-7-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3-[2-(1,3-dioxan-2-yl)ethyl]-2,4-dimethylcycloheptan-1-one (PubChem CID 11796712) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is (2S,3R,4S,7S)-7-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3-[2-(1,3-dioxan-2-yl)ethyl]-2,4-dimethylcycloheptan-1-one.
| Compound Name | (2S,3R,4S,7S)-7-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3-[2-(1,3-dioxan-2-yl)ethyl]-2,4-dimethylcycloheptan-1-one |
|---|---|
| PubChem CID | 11796712 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (2S,3R,4S,7S)-7-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-3-[2-(1,3-dioxan-2-yl)ethyl]-2,4-dimethylcycloheptan-1-one |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1CC[C@H](C)[C@@H](CCC2OCCCO2)[C@H](C)C1=O |
| InChI | InChI=1S/C24H46O4Si/c1-17-10-11-21(18(2)16-28-29(7,8)24(4,5)6)23(25)19(3)20(17)12-13-22-26-14-9-15-27-22/h17-22H,9-16H2,1-8H3/t17-,18+,19-,20+,21-/m0/s1 |
| InChIKey | VSLBUFRYVZRUJE-LUYSREMJSA-N |
| XLogP | 6.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|