C17H34O4Si — CID 10969594
(6S,7S)-4,6-dimethyl-7-(2-trimethylsilylethoxymethoxy)nonane-3,5-dione (PubChem CID 10969594) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (6S,7S)-4,6-dimethyl-7-(2-trimethylsilylethoxymethoxy)nonane-3,5-dione.
| Compound Name | (6S,7S)-4,6-dimethyl-7-(2-trimethylsilylethoxymethoxy)nonane-3,5-dione |
|---|---|
| PubChem CID | 10969594 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (6S,7S)-4,6-dimethyl-7-(2-trimethylsilylethoxymethoxy)nonane-3,5-dione |
| SMILES | CCC(=O)C(C)C(=O)[C@@H](C)[C@H](CC)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C17H34O4Si/c1-8-15(18)13(3)17(19)14(4)16(9-2)21-12-20-10-11-22(5,6)7/h13-14,16H,8-12H2,1-7H3/t13?,14-,16-/m0/s1 |
| InChIKey | RIGXIXRBPASYKW-DSUHRAPHSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|