C28H60O5Si2 — CID 135049191
(2R,4S,5R,6S,8R)-4,6-dimethoxy-2,8-dimethyl-5-triethylsilyloxy-9-tri(propan-2-yl)silyloxynonanal (PubChem CID 135049191) has the molecular formula C28H60O5Si2 and a molecular weight of 532.96 g/mol. Its IUPAC name is (2R,4S,5R,6S,8R)-4,6-dimethoxy-2,8-dimethyl-5-triethylsilyloxy-9-tri(propan-2-yl)silyloxynonanal.
| Compound Name | (2R,4S,5R,6S,8R)-4,6-dimethoxy-2,8-dimethyl-5-triethylsilyloxy-9-tri(propan-2-yl)silyloxynonanal |
|---|---|
| PubChem CID | 135049191 |
| Molecular Formula | C28H60O5Si2 |
| Molecular Weight | 532.96 g/mol |
| Exact Mass | 532.40 |
| IUPAC Name | (2R,4S,5R,6S,8R)-4,6-dimethoxy-2,8-dimethyl-5-triethylsilyloxy-9-tri(propan-2-yl)silyloxynonanal |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H](C[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)OC)[C@H](C[C@@H](C)C=O)OC |
| InChI | InChI=1S/C28H60O5Si2/c1-14-34(15-2,16-3)33-28(26(30-12)17-24(10)19-29)27(31-13)18-25(11)20-32-35(21(4)5,22(6)7)23(8)9/h19,21-28H,14-18,20H2,1-13H3/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | QXWMBDIRUXAHCB-MASCHLQQSA-N |
| XLogP | 7.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.96 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|