C22H48O4Si2 — CID 135027413
(3R,4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4,6-dimethyl-3-triethylsilyloxyheptanal (PubChem CID 135027413) has the molecular formula C22H48O4Si2 and a molecular weight of 432.79 g/mol. Its IUPAC name is (3R,4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4,6-dimethyl-3-triethylsilyloxyheptanal.
| Compound Name | (3R,4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4,6-dimethyl-3-triethylsilyloxyheptanal |
|---|---|
| PubChem CID | 135027413 |
| Molecular Formula | C22H48O4Si2 |
| Molecular Weight | 432.79 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (3R,4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-4,6-dimethyl-3-triethylsilyloxyheptanal |
| SMILES | CC[Si](CC)(CC)O[C@H](CC=O)[C@@](C)(C[C@@H](C)CO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C22H48O4Si2/c1-12-28(13-2,14-3)26-20(15-16-23)22(8,24-9)17-19(4)18-25-27(10,11)21(5,6)7/h16,19-20H,12-15,17-18H2,1-11H3/t19-,20-,22-/m1/s1 |
| InChIKey | BEFWEXUHMOTPGC-KCZVDYSFSA-N |
| XLogP | 6.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.79 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|