C21H46O4Si2 — CID 54577485
(3R,4R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4-methylheptanal (PubChem CID 54577485) has the molecular formula C21H46O4Si2 and a molecular weight of 418.77 g/mol. Its IUPAC name is (3R,4R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4-methylheptanal.
| Compound Name | (3R,4R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4-methylheptanal |
|---|---|
| PubChem CID | 54577485 |
| Molecular Formula | C21H46O4Si2 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (3R,4R)-4,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methoxy-4-methylheptanal |
| SMILES | CO[C@H](CC=O)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H46O4Si2/c1-19(2,3)26(9,10)24-17-13-15-21(7,18(23-8)14-16-22)25-27(11,12)20(4,5)6/h16,18H,13-15,17H2,1-12H3/t18-,21-/m1/s1 |
| InChIKey | OWVIVHXAPOPCGX-WIYYLYMNSA-N |
| XLogP | 6.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|