C26H58O4Si3 — CID 11785689
(2R,3S,4R,6R)-2,3,6-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methylheptanal (PubChem CID 11785689) has the molecular formula C26H58O4Si3 and a molecular weight of 519.00 g/mol. Its IUPAC name is (2R,3S,4R,6R)-2,3,6-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methylheptanal.
| Compound Name | (2R,3S,4R,6R)-2,3,6-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methylheptanal |
|---|---|
| PubChem CID | 11785689 |
| Molecular Formula | C26H58O4Si3 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | (2R,3S,4R,6R)-2,3,6-tris[[tert-butyl(dimethyl)silyl]oxy]-4-methylheptanal |
| SMILES | C[C@H](C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H58O4Si3/c1-20(18-21(2)28-31(12,13)24(3,4)5)23(30-33(16,17)26(9,10)11)22(19-27)29-32(14,15)25(6,7)8/h19-23H,18H2,1-17H3/t20-,21-,22+,23+/m1/s1 |
| InChIKey | DNTVVSHSIUJGCQ-LUKWVAJMSA-N |
| XLogP | 8.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|