C24H54O4Si3 — CID 24898007
(3R,4S,5R,7S)-5-methyl-3,4-bis(triethylsilyloxy)-7-trimethylsilyloxyoctan-2-one (PubChem CID 24898007) has the molecular formula C24H54O4Si3 and a molecular weight of 490.95 g/mol. Its IUPAC name is (3R,4S,5R,7S)-5-methyl-3,4-bis(triethylsilyloxy)-7-trimethylsilyloxyoctan-2-one.
| Compound Name | (3R,4S,5R,7S)-5-methyl-3,4-bis(triethylsilyloxy)-7-trimethylsilyloxyoctan-2-one |
|---|---|
| PubChem CID | 24898007 |
| Molecular Formula | C24H54O4Si3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | (3R,4S,5R,7S)-5-methyl-3,4-bis(triethylsilyloxy)-7-trimethylsilyloxyoctan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@H](C)C[C@H](C)O[Si](C)(C)C)[C@@H](O[Si](CC)(CC)CC)C(C)=O |
| InChI | InChI=1S/C24H54O4Si3/c1-13-30(14-2,15-3)27-23(20(7)19-21(8)26-29(10,11)12)24(22(9)25)28-31(16-4,17-5)18-6/h20-21,23-24H,13-19H2,1-12H3/t20-,21+,23+,24+/m1/s1 |
| InChIKey | BXMLWYGOMBLOKT-KJBBBAAKSA-N |
| XLogP | 7.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|