C15H32O4Si — CID 10662324
(3R,4S,5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-5-methyloctan-2-one (PubChem CID 10662324) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is (3R,4S,5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-5-methyloctan-2-one.
| Compound Name | (3R,4S,5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-5-methyloctan-2-one |
|---|---|
| PubChem CID | 10662324 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | (3R,4S,5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxy-5-methyloctan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](O)[C@H](C)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O4Si/c1-10(13(17)14(18)12(3)16)9-11(2)19-20(7,8)15(4,5)6/h10-11,13-14,17-18H,9H2,1-8H3/t10-,11+,13+,14+/m1/s1 |
| InChIKey | UGGJSZWHWCZCQZ-XWUBHJNHSA-N |
| XLogP | 2.73 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|