C33H74O5Si4 — CID 53483885
(3R,4S,5R,7R)-3,4,7,8-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloctan-2-one (PubChem CID 53483885) has the molecular formula C33H74O5Si4 and a molecular weight of 663.29 g/mol. Its IUPAC name is (3R,4S,5R,7R)-3,4,7,8-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloctan-2-one.
| Compound Name | (3R,4S,5R,7R)-3,4,7,8-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloctan-2-one |
|---|---|
| PubChem CID | 53483885 |
| Molecular Formula | C33H74O5Si4 |
| Molecular Weight | 663.29 g/mol |
| Exact Mass | 662.46 |
| IUPAC Name | (3R,4S,5R,7R)-3,4,7,8-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-5-methyloctan-2-one |
| SMILES | CC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H74O5Si4/c1-25(23-27(36-40(17,18)31(6,7)8)24-35-39(15,16)30(3,4)5)28(37-41(19,20)32(9,10)11)29(26(2)34)38-42(21,22)33(12,13)14/h25,27-29H,23-24H2,1-22H3/t25-,27-,28+,29+/m1/s1 |
| InChIKey | CNMVEQCIBSZZLM-RXIOLPMVSA-N |
| XLogP | 10.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.29 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|