C20H42O4Si2 — CID 11165563
(2S,3R,6S,7S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-7-methylcycloheptan-1-one (PubChem CID 11165563) has the molecular formula C20H42O4Si2 and a molecular weight of 402.72 g/mol. Its IUPAC name is (2S,3R,6S,7S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-7-methylcycloheptan-1-one.
| Compound Name | (2S,3R,6S,7S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-7-methylcycloheptan-1-one |
|---|---|
| PubChem CID | 11165563 |
| Molecular Formula | C20H42O4Si2 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (2S,3R,6S,7S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-7-methylcycloheptan-1-one |
| SMILES | C[C@@H]1C(=O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O4Si2/c1-14-15(23-25(8,9)19(2,3)4)12-13-16(18(22)17(14)21)24-26(10,11)20(5,6)7/h14-16,18,22H,12-13H2,1-11H3/t14-,15-,16+,18-/m0/s1 |
| InChIKey | RVSRUYXGQBCVEN-CUSZFKRNSA-N |
| XLogP | 5.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|