C27H60O4Si3 — CID 11295535
(3R,4S,5R,7R)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methyloctan-2-one (PubChem CID 11295535) has the molecular formula C27H60O4Si3 and a molecular weight of 533.03 g/mol. Its IUPAC name is (3R,4S,5R,7R)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methyloctan-2-one.
| Compound Name | (3R,4S,5R,7R)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methyloctan-2-one |
|---|---|
| PubChem CID | 11295535 |
| Molecular Formula | C27H60O4Si3 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | (3R,4S,5R,7R)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methyloctan-2-one |
| SMILES | CC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H60O4Si3/c1-20(19-21(2)29-32(13,14)25(4,5)6)23(30-33(15,16)26(7,8)9)24(22(3)28)31-34(17,18)27(10,11)12/h20-21,23-24H,19H2,1-18H3/t20-,21-,23+,24+/m1/s1 |
| InChIKey | HBDZPQBWUIMFHE-HTDNTCHWSA-N |
| XLogP | 8.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|