C25H54O3Si2 — CID 11070542
(4R,5S,6S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyldecan-3-one (PubChem CID 11070542) has the molecular formula C25H54O3Si2 and a molecular weight of 458.88 g/mol. Its IUPAC name is (4R,5S,6S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyldecan-3-one.
| Compound Name | (4R,5S,6S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyldecan-3-one |
|---|---|
| PubChem CID | 11070542 |
| Molecular Formula | C25H54O3Si2 |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | (4R,5S,6S)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyldecan-3-one |
| SMILES | CC(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O3Si2/c1-19(2)22(26)21(4)23(28-30(13,14)25(8,9)10)20(3)17-15-16-18-27-29(11,12)24(5,6)7/h19-21,23H,15-18H2,1-14H3/t20-,21-,23-/m0/s1 |
| InChIKey | JQJRQVMDNJVBIT-FUDKSRODSA-N |
| XLogP | 8.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|