C16H34O2Si — CID 46197383
(6S)-4,6-dimethyl-5-triethylsilyloxyoctan-3-one (PubChem CID 46197383) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is (6S)-4,6-dimethyl-5-triethylsilyloxyoctan-3-one.
| Compound Name | (6S)-4,6-dimethyl-5-triethylsilyloxyoctan-3-one |
|---|---|
| PubChem CID | 46197383 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (6S)-4,6-dimethyl-5-triethylsilyloxyoctan-3-one |
| SMILES | CCC(=O)C(C)C(O[Si](CC)(CC)CC)[C@@H](C)CC |
| InChI | InChI=1S/C16H34O2Si/c1-8-13(6)16(14(7)15(17)9-2)18-19(10-3,11-4)12-5/h13-14,16H,8-12H2,1-7H3/t13-,14?,16?/m0/s1 |
| InChIKey | OZGDVCKFMASAOV-HLIUYOAVSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|