C16H33O2Si — CID 134890037
CID 134890037 (PubChem CID 134890037) has the molecular formula C16H33O2Si and a molecular weight of 285.52 g/mol.
| Compound Name | CID 134890037 |
|---|---|
| PubChem CID | 134890037 |
| Molecular Formula | C16H33O2Si |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | — |
| SMILES | CC(C)C(=O)[C@@H](C)[C@H](O[Si](C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C16H33O2Si/c1-10(2)15(17)14(9)16(11(3)4)18-19(12(5)6)13(7)8/h10-14,16H,1-9H3/t14-,16-/m1/s1 |
| InChIKey | MMVXMHNMWHJBPE-GDBMZVCRSA-N |
| XLogP | 4.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|