C16H34O2Si — CID 135048113
(5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptan-3-one (PubChem CID 135048113) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptan-3-one.
| Compound Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptan-3-one |
|---|---|
| PubChem CID | 135048113 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6,6-trimethylheptan-3-one |
| SMILES | CC(C)C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H34O2Si/c1-12(2)13(17)11-14(15(3,4)5)18-19(9,10)16(6,7)8/h12,14H,11H2,1-10H3/t14-/m1/s1 |
| InChIKey | LTPIXXHCWNULDI-CQSZACIVSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|