C11H24O2Si — CID 11557578
(4S,5R)-4-methyl-5-trimethylsilyloxyheptan-3-one (PubChem CID 11557578) has the molecular formula C11H24O2Si and a molecular weight of 216.40 g/mol. Its IUPAC name is (4S,5R)-4-methyl-5-trimethylsilyloxyheptan-3-one.
| Compound Name | (4S,5R)-4-methyl-5-trimethylsilyloxyheptan-3-one |
|---|---|
| PubChem CID | 11557578 |
| Molecular Formula | C11H24O2Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (4S,5R)-4-methyl-5-trimethylsilyloxyheptan-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@@H](CC)O[Si](C)(C)C |
| InChI | InChI=1S/C11H24O2Si/c1-7-10(12)9(3)11(8-2)13-14(4,5)6/h9,11H,7-8H2,1-6H3/t9-,11-/m1/s1 |
| InChIKey | YSGMVCPFOPDTLA-MWLCHTKSSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|