C14H30O2Si — CID 11219118
(4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylheptan-3-one (PubChem CID 11219118) has the molecular formula C14H30O2Si and a molecular weight of 258.48 g/mol. Its IUPAC name is (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylheptan-3-one.
| Compound Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylheptan-3-one |
|---|---|
| PubChem CID | 11219118 |
| Molecular Formula | C14H30O2Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylheptan-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O2Si/c1-9-12(15)11(3)13(10-2)16-17(7,8)14(4,5)6/h11,13H,9-10H2,1-8H3/t11-,13-/m1/s1 |
| InChIKey | VNCCJUULVQXVPW-DGCLKSJQSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|