C15H32O2Si — CID 14662770
(2R,4R,5S)-2-[tert-butyl(dimethyl)silyl]-5-hydroxy-4,6-dimethylheptan-3-one (PubChem CID 14662770) has the molecular formula C15H32O2Si and a molecular weight of 272.50 g/mol. Its IUPAC name is (2R,4R,5S)-2-[tert-butyl(dimethyl)silyl]-5-hydroxy-4,6-dimethylheptan-3-one.
| Compound Name | (2R,4R,5S)-2-[tert-butyl(dimethyl)silyl]-5-hydroxy-4,6-dimethylheptan-3-one |
|---|---|
| PubChem CID | 14662770 |
| Molecular Formula | C15H32O2Si |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | (2R,4R,5S)-2-[tert-butyl(dimethyl)silyl]-5-hydroxy-4,6-dimethylheptan-3-one |
| SMILES | CC(C)[C@H](O)[C@@H](C)C(=O)[C@@H](C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O2Si/c1-10(2)13(16)11(3)14(17)12(4)18(8,9)15(5,6)7/h10-13,16H,1-9H3/t11-,12-,13+/m1/s1 |
| InChIKey | DHQVMDVHHZXWEO-UPJWGTAASA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|