C18H36O2Si — CID 134830919
(2S)-2-[(3S,4S,5S)-2,2-ditert-butyl-3,4-dimethyloxasilolan-5-yl]pentan-3-one (PubChem CID 134830919) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (2S)-2-[(3S,4S,5S)-2,2-ditert-butyl-3,4-dimethyloxasilolan-5-yl]pentan-3-one.
| Compound Name | (2S)-2-[(3S,4S,5S)-2,2-ditert-butyl-3,4-dimethyloxasilolan-5-yl]pentan-3-one |
|---|---|
| PubChem CID | 134830919 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2S)-2-[(3S,4S,5S)-2,2-ditert-butyl-3,4-dimethyloxasilolan-5-yl]pentan-3-one |
| SMILES | CCC(=O)[C@@H](C)[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C18H36O2Si/c1-11-15(19)13(3)16-12(2)14(4)21(20-16,17(5,6)7)18(8,9)10/h12-14,16H,11H2,1-10H3/t12-,13-,14+,16-/m1/s1 |
| InChIKey | YUYDVEORDKQVMW-HGTKMLMNSA-N |
| XLogP | 5.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|