C17H36O2Si — CID 139263534
(2S,3S)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxyheptanal (PubChem CID 139263534) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is (2S,3S)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxyheptanal.
| Compound Name | (2S,3S)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxyheptanal |
|---|---|
| PubChem CID | 139263534 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (2S,3S)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxyheptanal |
| SMILES | CCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)CCCC |
| InChI | InChI=1S/C17H36O2Si/c1-8-10-12-15(14-18)16(13-11-9-2)19-20(6,7)17(3,4)5/h14-16H,8-13H2,1-7H3/t15-,16+/m1/s1 |
| InChIKey | YELWISLTCAVZFO-CVEARBPZSA-N |
| XLogP | 5.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|