C33H72O4Si3 — CID 10908261
(3R,4S,5R,7S)-5-methyl-7-triethylsilyloxy-3,4-bis[tri(propan-2-yl)silyloxy]octan-2-one (PubChem CID 10908261) has the molecular formula C33H72O4Si3 and a molecular weight of 617.19 g/mol. Its IUPAC name is (3R,4S,5R,7S)-5-methyl-7-triethylsilyloxy-3,4-bis[tri(propan-2-yl)silyloxy]octan-2-one.
| Compound Name | (3R,4S,5R,7S)-5-methyl-7-triethylsilyloxy-3,4-bis[tri(propan-2-yl)silyloxy]octan-2-one |
|---|---|
| PubChem CID | 10908261 |
| Molecular Formula | C33H72O4Si3 |
| Molecular Weight | 617.19 g/mol |
| Exact Mass | 616.47 |
| IUPAC Name | (3R,4S,5R,7S)-5-methyl-7-triethylsilyloxy-3,4-bis[tri(propan-2-yl)silyloxy]octan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](C)C[C@@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)=O |
| InChI | InChI=1S/C33H72O4Si3/c1-19-38(20-2,21-3)35-30(17)22-29(16)32(36-39(23(4)5,24(6)7)25(8)9)33(31(18)34)37-40(26(10)11,27(12)13)28(14)15/h23-30,32-33H,19-22H2,1-18H3/t29-,30+,32+,33+/m1/s1 |
| InChIKey | VMFRTZVKUFLOGD-DRWBPFAOSA-N |
| XLogP | 11.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.19 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|