C34H74O4Si3 — CID 140515356
1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,8-trimethyltridecan-5-one (PubChem CID 140515356) has the molecular formula C34H74O4Si3 and a molecular weight of 631.22 g/mol. Its IUPAC name is 1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,8-trimethyltridecan-5-one.
| Compound Name | 1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,8-trimethyltridecan-5-one |
|---|---|
| PubChem CID | 140515356 |
| Molecular Formula | C34H74O4Si3 |
| Molecular Weight | 631.22 g/mol |
| Exact Mass | 630.49 |
| IUPAC Name | 1,3,7-tris[[tert-butyl(dimethyl)silyl]oxy]-4,4,8-trimethyltridecan-5-one |
| SMILES | CCCCCC(C)C(CC(=O)C(C)(C)C(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H74O4Si3/c1-20-21-22-23-27(2)28(37-40(16,17)32(6,7)8)26-29(35)34(12,13)30(38-41(18,19)33(9,10)11)24-25-36-39(14,15)31(3,4)5/h27-28,30H,20-26H2,1-19H3 |
| InChIKey | QHSPUTDDQRAONW-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.22 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|