C34H72O5Si3 — CID 11354231
(5S,6S,7R,10S)-6,10,12-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,9-tetramethyl-8-oxododecanal (PubChem CID 11354231) has the molecular formula C34H72O5Si3 and a molecular weight of 645.20 g/mol. Its IUPAC name is (5S,6S,7R,10S)-6,10,12-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,9-tetramethyl-8-oxododecanal.
| Compound Name | (5S,6S,7R,10S)-6,10,12-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,9-tetramethyl-8-oxododecanal |
|---|---|
| PubChem CID | 11354231 |
| Molecular Formula | C34H72O5Si3 |
| Molecular Weight | 645.20 g/mol |
| Exact Mass | 644.47 |
| IUPAC Name | (5S,6S,7R,10S)-6,10,12-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9,9-tetramethyl-8-oxododecanal |
| SMILES | C[C@@H](CCCC=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H72O5Si3/c1-26(22-20-21-24-35)29(39-42(18,19)33(9,10)11)27(2)30(36)34(12,13)28(38-41(16,17)32(6,7)8)23-25-37-40(14,15)31(3,4)5/h24,26-29H,20-23,25H2,1-19H3/t26-,27+,28-,29-/m0/s1 |
| InChIKey | ADDSZDSMZMZXIF-CRNKYVSFSA-N |
| XLogP | 10.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.20 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|