C46H100O7Si5 — CID 134970719
(3S,5S,9R,11R)-3,5,9,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-7-tri(propan-2-yl)silyloxytridecanedial (PubChem CID 134970719) has the molecular formula C46H100O7Si5 and a molecular weight of 905.73 g/mol. Its IUPAC name is (3S,5S,9R,11R)-3,5,9,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-7-tri(propan-2-yl)silyloxytridecanedial.
| Compound Name | (3S,5S,9R,11R)-3,5,9,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-7-tri(propan-2-yl)silyloxytridecanedial |
|---|---|
| PubChem CID | 134970719 |
| Molecular Formula | C46H100O7Si5 |
| Molecular Weight | 905.73 g/mol |
| Exact Mass | 904.63 |
| IUPAC Name | (3S,5S,9R,11R)-3,5,9,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-7-tri(propan-2-yl)silyloxytridecanedial |
| SMILES | CC(C)[Si](OC(C[C@H](C[C@H](CC=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C[C@@H](C[C@@H](CC=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C46H100O7Si5/c1-35(2)58(36(3)4,37(5)6)53-42(33-40(51-56(23,24)45(13,14)15)31-38(27-29-47)49-54(19,20)43(7,8)9)34-41(52-57(25,26)46(16,17)18)32-39(28-30-48)50-55(21,22)44(10,11)12/h29-30,35-42H,27-28,31-34H2,1-26H3/t38-,39+,40-,41+,42? |
| InChIKey | XJQGMTCWEGMETJ-DXDGJGPESA-N |
| XLogP | 14.85 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.73 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|