C26H58O4Si3 — CID 11988980
(3R,5R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyoctanal (PubChem CID 11988980) has the molecular formula C26H58O4Si3 and a molecular weight of 519.00 g/mol. Its IUPAC name is (3R,5R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyoctanal.
| Compound Name | (3R,5R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyoctanal |
|---|---|
| PubChem CID | 11988980 |
| Molecular Formula | C26H58O4Si3 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | (3R,5R,7R)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyoctanal |
| SMILES | CC[Si](CC)(CC)O[C@@H](C[C@H](CC=O)O[Si](C)(C)C(C)(C)C)C[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H58O4Si3/c1-15-33(16-2,17-3)30-24(20-22(4)28-31(11,12)25(5,6)7)21-23(18-19-27)29-32(13,14)26(8,9)10/h19,22-24H,15-18,20-21H2,1-14H3/t22-,23+,24-/m1/s1 |
| InChIKey | CHDNOJJEOJRJLS-TZRRMPRUSA-N |
| XLogP | 8.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|