C48H104O9Si5 — CID 134934797
dimethyl (3S,5S,9R,11S)-3,5,9,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-7-tri(propan-2-yl)silyloxytridecanedioate (PubChem CID 134934797) has the molecular formula C48H104O9Si5 and a molecular weight of 965.78 g/mol. Its IUPAC name is dimethyl (3S,5S,9R,11S)-3,5,9,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-7-tri(propan-2-yl)silyloxytridecanedioate.
| Compound Name | dimethyl (3S,5S,9R,11S)-3,5,9,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-7-tri(propan-2-yl)silyloxytridecanedioate |
|---|---|
| PubChem CID | 134934797 |
| Molecular Formula | C48H104O9Si5 |
| Molecular Weight | 965.78 g/mol |
| Exact Mass | 964.65 |
| IUPAC Name | dimethyl (3S,5S,9R,11S)-3,5,9,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-7-tri(propan-2-yl)silyloxytridecanedioate |
| SMILES | COC(=O)C[C@H](C[C@@H](CC(C[C@@H](C[C@@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C48H104O9Si5/c1-35(2)62(36(3)4,37(5)6)57-40(29-38(53-58(21,22)45(7,8)9)31-41(33-43(49)51-19)55-60(25,26)47(13,14)15)30-39(54-59(23,24)46(10,11)12)32-42(34-44(50)52-20)56-61(27,28)48(16,17)18/h35-42H,29-34H2,1-28H3/t38-,39+,40?,41-,42-/m0/s1 |
| InChIKey | RZAUKVTYMFZIAI-WNYVQMDYSA-N |
| XLogP | 14.80 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.78 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|