C24H44O9Si — CID 15162943
dimethyl (5R,9S)-5,9-dihydroxy-3,11-dioxo-7-tri(propan-2-yl)silyloxytridecanedioate (PubChem CID 15162943) has the molecular formula C24H44O9Si and a molecular weight of 504.69 g/mol. Its IUPAC name is dimethyl (5R,9S)-5,9-dihydroxy-3,11-dioxo-7-tri(propan-2-yl)silyloxytridecanedioate.
| Compound Name | dimethyl (5R,9S)-5,9-dihydroxy-3,11-dioxo-7-tri(propan-2-yl)silyloxytridecanedioate |
|---|---|
| PubChem CID | 15162943 |
| Molecular Formula | C24H44O9Si |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | dimethyl (5R,9S)-5,9-dihydroxy-3,11-dioxo-7-tri(propan-2-yl)silyloxytridecanedioate |
| SMILES | COC(=O)CC(=O)C[C@@H](O)CC(C[C@@H](O)CC(=O)CC(=O)OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H44O9Si/c1-15(2)34(16(3)4,17(5)6)33-22(11-18(25)9-20(27)13-23(29)31-7)12-19(26)10-21(28)14-24(30)32-8/h15-19,22,25-26H,9-14H2,1-8H3/t18-,19+,22? |
| InChIKey | WSEDVELGHWHQHL-QIDMFYOTSA-N |
| XLogP | 3.09 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|