C16H34O5Si — CID 14760943
methyl (3R,5R)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 14760943) has the molecular formula C16H34O5Si and a molecular weight of 334.53 g/mol. Its IUPAC name is methyl (3R,5R)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | methyl (3R,5R)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 14760943 |
| Molecular Formula | C16H34O5Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | methyl (3R,5R)-3,5-dihydroxy-6-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | COC(=O)C[C@H](O)C[C@@H](O)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H34O5Si/c1-11(2)22(12(3)4,13(5)6)21-10-15(18)8-14(17)9-16(19)20-7/h11-15,17-18H,8-10H2,1-7H3/t14-,15-/m1/s1 |
| InChIKey | JQYGGVNTJRBMJX-HUUCEWRRSA-N |
| XLogP | 2.85 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|