C17H32O4 — CID 10859571
methyl (3R,5R,9R,11R)-12-hydroxy-3,5,9,11-tetramethyl-7-oxododecanoate (PubChem CID 10859571) has the molecular formula C17H32O4 and a molecular weight of 300.44 g/mol. Its IUPAC name is methyl (3R,5R,9R,11R)-12-hydroxy-3,5,9,11-tetramethyl-7-oxododecanoate.
| Compound Name | methyl (3R,5R,9R,11R)-12-hydroxy-3,5,9,11-tetramethyl-7-oxododecanoate |
|---|---|
| PubChem CID | 10859571 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | methyl (3R,5R,9R,11R)-12-hydroxy-3,5,9,11-tetramethyl-7-oxododecanoate |
| SMILES | COC(=O)C[C@H](C)C[C@@H](C)CC(=O)C[C@H](C)C[C@@H](C)CO |
| InChI | InChI=1S/C17H32O4/c1-12(6-14(3)10-17(20)21-5)8-16(19)9-13(2)7-15(4)11-18/h12-15,18H,6-11H2,1-5H3/t12-,13-,14-,15-/m1/s1 |
| InChIKey | JYZQMACCRRAXKM-KBUPBQIOSA-N |
| XLogP | 3.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |