C17H32O5 — CID 13390964
ethyl 5-hydroxy-11-methoxy-7,11-dimethyl-3-oxododecanoate (PubChem CID 13390964) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is ethyl 5-hydroxy-11-methoxy-7,11-dimethyl-3-oxododecanoate.
| Compound Name | ethyl 5-hydroxy-11-methoxy-7,11-dimethyl-3-oxododecanoate |
|---|---|
| PubChem CID | 13390964 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | ethyl 5-hydroxy-11-methoxy-7,11-dimethyl-3-oxododecanoate |
| SMILES | CCOC(=O)CC(=O)CC(O)CC(C)CCCC(C)(C)OC |
| InChI | InChI=1S/C17H32O5/c1-6-22-16(20)12-15(19)11-14(18)10-13(2)8-7-9-17(3,4)21-5/h13-14,18H,6-12H2,1-5H3 |
| InChIKey | HNPPYGKOZVDFPP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|