About diethyl 3-methylheptanedioate
diethyl 3-methylheptanedioate (PubChem CID 121008602) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is diethyl 3-methylheptanedioate.
Molecular Properties
| Compound Name | diethyl 3-methylheptanedioate |
| PubChem CID | 121008602 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | diethyl 3-methylheptanedioate |
| SMILES | CCOC(=O)CCCC(C)CC(=O)OCC |
| InChI | InChI=1S/C12H22O4/c1-4-15-11(13)8-6-7-10(3)9-12(14)16-5-2/h10H,4-9H2,1-3H3 |
| InChIKey | CEFRPJWASZYWLC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze diethyl 3-methylheptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 3-methylheptanedioate?
The IUPAC name of diethyl 3-methylheptanedioate (CID 121008602) is diethyl 3-methylheptanedioate.
What is the SMILES notation for diethyl 3-methylheptanedioate?
The canonical SMILES for diethyl 3-methylheptanedioate is CCOC(=O)CCCC(C)CC(=O)OCC.
What is the InChIKey of diethyl 3-methylheptanedioate?
The InChIKey is CEFRPJWASZYWLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-4-15-11(13)8-6-7-10(3)9-12(14)16-5-2/h10H,4-9H2,1-3H3.
What are the key properties of diethyl 3-methylheptanedioate?
diethyl 3-methylheptanedioate has a molecular weight of 230.30 g/mol, XLogP of 2.31, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 3-methylheptanedioate is sourced from PubChem (CID 121008602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).