C13H24O3 — CID 14369249
methyl (5R)-5,9-dimethyl-3-oxodecanoate (PubChem CID 14369249) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is methyl (5R)-5,9-dimethyl-3-oxodecanoate.
| Compound Name | methyl (5R)-5,9-dimethyl-3-oxodecanoate |
|---|---|
| PubChem CID | 14369249 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | methyl (5R)-5,9-dimethyl-3-oxodecanoate |
| SMILES | COC(=O)CC(=O)C[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C13H24O3/c1-10(2)6-5-7-11(3)8-12(14)9-13(15)16-4/h10-11H,5-9H2,1-4H3/t11-/m1/s1 |
| InChIKey | RJSUYKKBZILFOJ-LLVKDONJSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|