C13H27O4P — CID 22151517
1-dimethoxyphosphoryl-4,8-dimethylnonan-2-one (PubChem CID 22151517) has the molecular formula C13H27O4P and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-4,8-dimethylnonan-2-one.
| Compound Name | 1-dimethoxyphosphoryl-4,8-dimethylnonan-2-one |
|---|---|
| PubChem CID | 22151517 |
| Molecular Formula | C13H27O4P |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-dimethoxyphosphoryl-4,8-dimethylnonan-2-one |
| SMILES | COP(=O)(CC(=O)CC(C)CCCC(C)C)OC |
| InChI | InChI=1S/C13H27O4P/c1-11(2)7-6-8-12(3)9-13(14)10-18(15,16-4)17-5/h11-12H,6-10H2,1-5H3 |
| InChIKey | IKFDIQIQTKQILV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|