C13H21F6O4P — CID 132568350
1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-methyloctan-2-one (PubChem CID 132568350) has the molecular formula C13H21F6O4P and a molecular weight of 386.27 g/mol. Its IUPAC name is 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-methyloctan-2-one.
| Compound Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-methyloctan-2-one |
|---|---|
| PubChem CID | 132568350 |
| Molecular Formula | C13H21F6O4P |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-methyloctan-2-one |
| SMILES | CCCCC(C)CC(=O)CP(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C13H21F6O4P/c1-3-4-5-10(2)6-11(20)7-24(21,22-8-12(14,15)16)23-9-13(17,18)19/h10H,3-9H2,1-2H3 |
| InChIKey | SLQBOUFPVSMHMM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|