C24H46F2O8P2 — CID 130456065
1-dibutoxyphosphoryl-1,1-difluoro-3,5-dimethyl-6-[(3-methyl-2-oxobutyl)-propoxyphosphoryl]oxyhexan-2-one (PubChem CID 130456065) has the molecular formula C24H46F2O8P2 and a molecular weight of 562.57 g/mol. Its IUPAC name is 1-dibutoxyphosphoryl-1,1-difluoro-3,5-dimethyl-6-[(3-methyl-2-oxobutyl)-propoxyphosphoryl]oxyhexan-2-one.
| Compound Name | 1-dibutoxyphosphoryl-1,1-difluoro-3,5-dimethyl-6-[(3-methyl-2-oxobutyl)-propoxyphosphoryl]oxyhexan-2-one |
|---|---|
| PubChem CID | 130456065 |
| Molecular Formula | C24H46F2O8P2 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 1-dibutoxyphosphoryl-1,1-difluoro-3,5-dimethyl-6-[(3-methyl-2-oxobutyl)-propoxyphosphoryl]oxyhexan-2-one |
| SMILES | CCCCOP(=O)(OCCCC)C(F)(F)C(=O)C(C)CC(C)COP(=O)(CC(=O)C(C)C)OCCC |
| InChI | InChI=1S/C24H46F2O8P2/c1-8-11-14-32-36(30,33-15-12-9-2)24(25,26)23(28)21(7)16-20(6)17-34-35(29,31-13-10-3)18-22(27)19(4)5/h19-21H,8-18H2,1-7H3 |
| InChIKey | QVBRQAUMBDNKHD-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|