C19H42O3Si2 — CID 134931168
(2S,3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-trimethylsilyloxyoctanal (PubChem CID 134931168) has the molecular formula C19H42O3Si2 and a molecular weight of 374.71 g/mol. Its IUPAC name is (2S,3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-trimethylsilyloxyoctanal.
| Compound Name | (2S,3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-trimethylsilyloxyoctanal |
|---|---|
| PubChem CID | 134931168 |
| Molecular Formula | C19H42O3Si2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (2S,3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-trimethylsilyloxyoctanal |
| SMILES | CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C19H42O3Si2/c1-12-13-17(21-24(10,11)19(4,5)6)16(3)18(15(2)14-20)22-23(7,8)9/h14-18H,12-13H2,1-11H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | CXVSEIXHZACFBZ-XMTFNYHQSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|