C20H44O3Si2 — CID 72701907
(2R,3S,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-triethylsilyloxyhexanal (PubChem CID 72701907) has the molecular formula C20H44O3Si2 and a molecular weight of 388.74 g/mol. Its IUPAC name is (2R,3S,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-triethylsilyloxyhexanal.
| Compound Name | (2R,3S,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-triethylsilyloxyhexanal |
|---|---|
| PubChem CID | 72701907 |
| Molecular Formula | C20H44O3Si2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (2R,3S,4S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-triethylsilyloxyhexanal |
| SMILES | CC[Si](CC)(CC)O[C@@H](C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C20H44O3Si2/c1-12-25(13-2,14-3)22-18(6)17(5)19(16(4)15-21)23-24(10,11)20(7,8)9/h15-19H,12-14H2,1-11H3/t16-,17-,18-,19+/m0/s1 |
| InChIKey | RFTKZKZNKLCJIZ-CADBVGFASA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|