C20H44O4Si2 — CID 11750070
(2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methyl-3-triethylsilyloxyhexanal (PubChem CID 11750070) has the molecular formula C20H44O4Si2 and a molecular weight of 404.74 g/mol. Its IUPAC name is (2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methyl-3-triethylsilyloxyhexanal.
| Compound Name | (2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methyl-3-triethylsilyloxyhexanal |
|---|---|
| PubChem CID | 11750070 |
| Molecular Formula | C20H44O4Si2 |
| Molecular Weight | 404.74 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (2S,3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-2-methyl-3-triethylsilyloxyhexanal |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](COC)O[Si](C)(C)C(C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C20H44O4Si2/c1-11-26(12-2,13-3)24-19(17(4)15-21)14-18(16-22-8)23-25(9,10)20(5,6)7/h15,17-19H,11-14,16H2,1-10H3/t17-,18-,19-/m1/s1 |
| InChIKey | LHCLWQUKBRWDKI-GUDVDZBRSA-N |
| XLogP | 5.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.74 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|