C21H42O6Si2 — CID 10972342
(2S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-[(4S)-4-methyl-2-oxo-1,3-dioxolan-4-yl]-3-triethylsilyloxybutanal (PubChem CID 10972342) has the molecular formula C21H42O6Si2 and a molecular weight of 446.73 g/mol. Its IUPAC name is (2S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-[(4S)-4-methyl-2-oxo-1,3-dioxolan-4-yl]-3-triethylsilyloxybutanal.
| Compound Name | (2S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-[(4S)-4-methyl-2-oxo-1,3-dioxolan-4-yl]-3-triethylsilyloxybutanal |
|---|---|
| PubChem CID | 10972342 |
| Molecular Formula | C21H42O6Si2 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (2S,3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-4-[(4S)-4-methyl-2-oxo-1,3-dioxolan-4-yl]-3-triethylsilyloxybutanal |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@H](C)C=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)COC(=O)O1 |
| InChI | InChI=1S/C21H42O6Si2/c1-11-29(12-2,13-3)26-17(16(4)14-22)18(21(8)15-24-19(23)25-21)27-28(9,10)20(5,6)7/h14,16-18H,11-13,15H2,1-10H3/t16-,17-,18+,21+/m1/s1 |
| InChIKey | QMVAKXIBGWEWRD-WIRSXHRWSA-N |
| XLogP | 5.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|