C15H32O4Si — CID 14110924
(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2-methylhexanal (PubChem CID 14110924) has the molecular formula C15H32O4Si and a molecular weight of 304.50 g/mol. Its IUPAC name is (2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2-methylhexanal.
| Compound Name | (2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2-methylhexanal |
|---|---|
| PubChem CID | 14110924 |
| Molecular Formula | C15H32O4Si |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | (2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2-methylhexanal |
| SMILES | COC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC(C)C=O)OC |
| InChI | InChI=1S/C15H32O4Si/c1-12(10-16)9-13(18-6)14(11-17-5)19-20(7,8)15(2,3)4/h10,12-14H,9,11H2,1-8H3/t12?,13-,14+/m0/s1 |
| InChIKey | PKMKLQYGDDRHHS-KFTPUPIBSA-N |
| XLogP | 3.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|