C23H50O3Si2 — CID 11304990
(2R,3S,4S,5S)-2,4-dimethyl-3-triethylsilyloxy-5-tri(propan-2-yl)silyloxyhexanal (PubChem CID 11304990) has the molecular formula C23H50O3Si2 and a molecular weight of 430.82 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2,4-dimethyl-3-triethylsilyloxy-5-tri(propan-2-yl)silyloxyhexanal.
| Compound Name | (2R,3S,4S,5S)-2,4-dimethyl-3-triethylsilyloxy-5-tri(propan-2-yl)silyloxyhexanal |
|---|---|
| PubChem CID | 11304990 |
| Molecular Formula | C23H50O3Si2 |
| Molecular Weight | 430.82 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | (2R,3S,4S,5S)-2,4-dimethyl-3-triethylsilyloxy-5-tri(propan-2-yl)silyloxyhexanal |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C23H50O3Si2/c1-13-27(14-2,15-3)26-23(20(10)16-24)21(11)22(12)25-28(17(4)5,18(6)7)19(8)9/h16-23H,13-15H2,1-12H3/t20-,21-,22-,23+/m0/s1 |
| InChIKey | QHJCJTZAXDJWFI-CWBXHPNXSA-N |
| XLogP | 7.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.82 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|