C20H44O3Si2 — CID 11003629
(2S,3S,4R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylhexanal (PubChem CID 11003629) has the molecular formula C20H44O3Si2 and a molecular weight of 388.74 g/mol. Its IUPAC name is (2S,3S,4R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylhexanal.
| Compound Name | (2S,3S,4R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylhexanal |
|---|---|
| PubChem CID | 11003629 |
| Molecular Formula | C20H44O3Si2 |
| Molecular Weight | 388.74 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (2S,3S,4R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4-dimethylhexanal |
| SMILES | CC(C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O3Si2/c1-16(13-14-22-24(9,10)19(3,4)5)18(17(2)15-21)23-25(11,12)20(6,7)8/h15-18H,13-14H2,1-12H3/t16-,17?,18+/m1/s1 |
| InChIKey | RIDVFIYBSJTDEM-BLAYRMRBSA-N |
| XLogP | 6.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.74 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|