C57H120O6Si5 — CID 10558009
(3R,5S,8R,9S,10R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethyl-3,5,8,9-tetrakis[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one (PubChem CID 10558009) has the molecular formula C57H120O6Si5 and a molecular weight of 1042.01 g/mol. Its IUPAC name is (3R,5S,8R,9S,10R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethyl-3,5,8,9-tetrakis[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one.
| Compound Name | (3R,5S,8R,9S,10R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethyl-3,5,8,9-tetrakis[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one |
|---|---|
| PubChem CID | 10558009 |
| Molecular Formula | C57H120O6Si5 |
| Molecular Weight | 1042.01 g/mol |
| Exact Mass | 1040.79 |
| IUPAC Name | (3R,5S,8R,9S,10R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-3,10-dimethyl-3,5,8,9-tetrakis[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one |
| SMILES | C#C[C@@](C)(C[C@@H](CC(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C57H120O6Si5/c1-34-57(31,63-68(47(20)21,48(22)23)49(24)25)37-52(60-65(38(2)3,39(4)5)40(6)7)36-53(58)55(62-67(44(14)15,45(16)17)46(18)19)54(61-66(41(8)9,42(10)11)43(12)13)50(26)35-51(27)59-64(32,33)56(28,29)30/h1,38-52,54-55H,35-37H2,2-33H3/t50-,51+,52-,54+,55+,57+/m1/s1 |
| InChIKey | KPKPYXHUKOVCPU-UALLBEQNSA-N |
| XLogP | 19.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.01 |
| LogP ≤ 5 | 19.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|