C21H44O3Si2 — CID 10644709
(2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-cyclohexylpropanal (PubChem CID 10644709) has the molecular formula C21H44O3Si2 and a molecular weight of 400.75 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-cyclohexylpropanal.
| Compound Name | (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-cyclohexylpropanal |
|---|---|
| PubChem CID | 10644709 |
| Molecular Formula | C21H44O3Si2 |
| Molecular Weight | 400.75 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-cyclohexylpropanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C=O)[C@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C21H44O3Si2/c1-20(2,3)25(7,8)23-18(16-22)19(17-14-12-11-13-15-17)24-26(9,10)21(4,5)6/h16-19H,11-15H2,1-10H3/t18-,19+/m0/s1 |
| InChIKey | FELJJEJBOJOKJL-RBUKOAKNSA-N |
| XLogP | 6.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.75 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|