C9H18O5 — CID 134971429
(3R,4S,5R,7R)-3,4,7,8-tetrahydroxy-5-methyloctan-2-one (PubChem CID 134971429) has the molecular formula C9H18O5 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3R,4S,5R,7R)-3,4,7,8-tetrahydroxy-5-methyloctan-2-one.
| Compound Name | (3R,4S,5R,7R)-3,4,7,8-tetrahydroxy-5-methyloctan-2-one |
|---|---|
| PubChem CID | 134971429 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (3R,4S,5R,7R)-3,4,7,8-tetrahydroxy-5-methyloctan-2-one |
| SMILES | CC(=O)[C@H](O)[C@@H](O)[C@H](C)C[C@@H](O)CO |
| InChI | InChI=1S/C9H18O5/c1-5(3-7(12)4-10)8(13)9(14)6(2)11/h5,7-10,12-14H,3-4H2,1-2H3/t5-,7-,8+,9+/m1/s1 |
| InChIKey | XRWQDWDZMXPHMX-ZLNHGNLKSA-N |
| XLogP | -1.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |